lavoisiermod

``` from rdkit import Chem from chembl_structure_pipeline import standardizer # a molecule with enhanced stereochemistry m3bis = Chem.MolFromSmiles('Cl.O[C@@H]1CC[C@H](Cl)C[C@@H]1O |a:5,&1:2,8|') m3bis ```  (the carbon bearing Cl has absolute configuration, the...

'r' and 's' CIP configuration changes when chiral fragments are added to the molecule

1

**Describe the bug** An sp3 stereogenic center that has 's' CIP configuration switches to 'S' when a part of the molecule that is unrelated (in terms of _local_ symmetry) changes....