The application crashes when there are fewer than two data points in the line chart.

[mrihsann]

When there are less than two data in the line chart, if we touch the chart, the application crashes. If we do not use the line list as remember, the line is constantly recomposed.

As a solution, I use a structure like the one below.

val lineValues = when (uiState.resultListLast30Days.size) {
    0 -> listOf(0.0, 0.0) // If there is no data (0.0, 0.0)
    1 -> listOf(0.0,uiState.resultListLast30Days[0]) // If there is only one data (first data, 0.0)
    else -> uiState.resultListLast30Days // If there are two or more data, use it as is.
}

val lines = remember(lineValues) {
    listOf(
        Line(
            label = "",
            values = lineValues,
            color = SolidColor(Color(0xFF23af92)),
            firstGradientFillColor = Color(0xFF2BC0A1).copy(alpha = .5f),
            secondGradientFillColor = Color.Transparent,
            strokeAnimationSpec = tween(2000, easing = EaseInOutCubic),
            gradientAnimationDelay = 1000,
            drawStyle = DrawStyle.Stroke(width = 2.dp),
        )
    )
}
LineChart(
            modifier = Modifier
                .fillMaxWidth()
                .height(200.dp),
            labelHelperProperties = LabelHelperProperties(
                enabled = false
            ),
            indicatorProperties =  HorizontalIndicatorProperties(
                textStyle = MaterialTheme.typography.bodySmall.copy(color = MaterialTheme.colorScheme.onSurface)
            ),
            gridProperties = GridProperties(
                enabled = false
            ),
            data = lines,
            animationMode = AnimationMode.Together(delayBuilder = {
                it * 500L
            }),
        )

[ehsannarmani]

@mrihsann thank you for reporting the problem, ill check.

[ehsannarmani]

Hi, in the 0.0.15 version this issue should resolved. Check and test, if issue still exist, reopen the issue.

Thank you for reporting the problem.