backup when using Vescalagin

[AlcedoAttis]

by inputting Vescalagin, (a complex molecule,) a backup is caused somewhere. I'd guess that a string "Backup" is returned and falsely interpreted.

[lambdacasserole]

Hi there, thank you for bringing this to my attention. The "backup" image is passed back when something goes wrong while querying the Sourire API. In fact the exact line that results in the backup molecule is right here. Here's the SMILES string that actually breaks it:

O[C@H]1[C@H]2OC(=O)c3c1c(O)c(O)c(O)c3c4c(O)c(O)c(O)c5c4C(=O)OC2[C@@H]6OC(=O)c7cc(O)c(O)c(O)c7c8c(O)c(O)c(O)cc8C(=O)OCC6OC(=O)c9cc(O)c(O)c(O)c59

Further investigation required.